C22H22N2O3 — CID 31186982
1-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-4-phenylbutane-1,4-dione (PubChem CID 31186982) has the molecular formula C22H22N2O3 and a molecular weight of 362.43 g/mol. Its IUPAC name is 1-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-4-phenylbutane-1,4-dione.
| Compound Name | 1-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-4-phenylbutane-1,4-dione |
|---|---|
| PubChem CID | 31186982 |
| Molecular Formula | C22H22N2O3 |
| Molecular Weight | 362.43 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 1-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-4-phenylbutane-1,4-dione |
| SMILES | O=C(CCC(=O)N1CCC(c2nc3ccccc3o2)CC1)c1ccccc1 |
| InChI | InChI=1S/C22H22N2O3/c25-19(16-6-2-1-3-7-16)10-11-21(26)24-14-12-17(13-15-24)22-23-18-8-4-5-9-20(18)27-22/h1-9,17H,10-15H2 |
| InChIKey | MXVHLRUUCJUUKF-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 63.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.43 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |