C27H23N3O3 — CID 55502854
10-[2-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-2-oxoethyl]acridin-9-one (PubChem CID 55502854) has the molecular formula C27H23N3O3 and a molecular weight of 437.50 g/mol. Its IUPAC name is 10-[2-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-2-oxoethyl]acridin-9-one.
| Compound Name | 10-[2-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-2-oxoethyl]acridin-9-one |
|---|---|
| PubChem CID | 55502854 |
| Molecular Formula | C27H23N3O3 |
| Molecular Weight | 437.50 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | 10-[2-[4-(1,3-benzoxazol-2-yl)piperidin-1-yl]-2-oxoethyl]acridin-9-one |
| SMILES | O=C(Cn1c2ccccc2c(=O)c2ccccc21)N1CCC(c2nc3ccccc3o2)CC1 |
| InChI | InChI=1S/C27H23N3O3/c31-25(29-15-13-18(14-16-29)27-28-21-9-3-6-12-24(21)33-27)17-30-22-10-4-1-7-19(22)26(32)20-8-2-5-11-23(20)30/h1-12,18H,13-17H2 |
| InChIKey | STGUACWZBQXRAW-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 68.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.50 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|