C22H26ClN3O2 — CID 119544334
10-[2-[4-(methylaminomethyl)piperidin-1-yl]-2-oxoethyl]acridin-9-one;hydrochloride (PubChem CID 119544334) has the molecular formula C22H26ClN3O2 and a molecular weight of 399.92 g/mol. Its IUPAC name is 10-[2-[4-(methylaminomethyl)piperidin-1-yl]-2-oxoethyl]acridin-9-one;hydrochloride.
| Compound Name | 10-[2-[4-(methylaminomethyl)piperidin-1-yl]-2-oxoethyl]acridin-9-one;hydrochloride |
|---|---|
| PubChem CID | 119544334 |
| Molecular Formula | C22H26ClN3O2 |
| Molecular Weight | 399.92 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | 10-[2-[4-(methylaminomethyl)piperidin-1-yl]-2-oxoethyl]acridin-9-one;hydrochloride |
| SMILES | CNCC1CCN(C(=O)Cn2c3ccccc3c(=O)c3ccccc32)CC1.Cl |
| InChI | InChI=1S/C22H25N3O2.ClH/c1-23-14-16-10-12-24(13-11-16)21(26)15-25-19-8-4-2-6-17(19)22(27)18-7-3-5-9-20(18)25;/h2-9,16,23H,10-15H2,1H3;1H |
| InChIKey | XGDUYAMBOWFWFO-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.92 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|