C23H26N4O3 — CID 46518244
N,N-dimethyl-2-[4-[2-(9-oxoacridin-10-yl)acetyl]piperazin-1-yl]acetamide (PubChem CID 46518244) has the molecular formula C23H26N4O3 and a molecular weight of 406.49 g/mol. Its IUPAC name is N,N-dimethyl-2-[4-[2-(9-oxoacridin-10-yl)acetyl]piperazin-1-yl]acetamide.
| Compound Name | N,N-dimethyl-2-[4-[2-(9-oxoacridin-10-yl)acetyl]piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 46518244 |
| Molecular Formula | C23H26N4O3 |
| Molecular Weight | 406.49 g/mol |
| Exact Mass | 406.20 |
| IUPAC Name | N,N-dimethyl-2-[4-[2-(9-oxoacridin-10-yl)acetyl]piperazin-1-yl]acetamide |
| SMILES | CN(C)C(=O)CN1CCN(C(=O)Cn2c3ccccc3c(=O)c3ccccc32)CC1 |
| InChI | InChI=1S/C23H26N4O3/c1-24(2)21(28)15-25-11-13-26(14-12-25)22(29)16-27-19-9-5-3-7-17(19)23(30)18-8-4-6-10-20(18)27/h3-10H,11-16H2,1-2H3 |
| InChIKey | PCIJNGJBHNZWKB-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 65.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.49 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|