C21H24ClN3O2 — CID 119539969
10-[2-[3-(methylaminomethyl)pyrrolidin-1-yl]-2-oxoethyl]acridin-9-one;hydrochloride (PubChem CID 119539969) has the molecular formula C21H24ClN3O2 and a molecular weight of 385.90 g/mol. Its IUPAC name is 10-[2-[3-(methylaminomethyl)pyrrolidin-1-yl]-2-oxoethyl]acridin-9-one;hydrochloride.
| Compound Name | 10-[2-[3-(methylaminomethyl)pyrrolidin-1-yl]-2-oxoethyl]acridin-9-one;hydrochloride |
|---|---|
| PubChem CID | 119539969 |
| Molecular Formula | C21H24ClN3O2 |
| Molecular Weight | 385.90 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 10-[2-[3-(methylaminomethyl)pyrrolidin-1-yl]-2-oxoethyl]acridin-9-one;hydrochloride |
| SMILES | CNCC1CCN(C(=O)Cn2c3ccccc3c(=O)c3ccccc32)C1.Cl |
| InChI | InChI=1S/C21H23N3O2.ClH/c1-22-12-15-10-11-23(13-15)20(25)14-24-18-8-4-2-6-16(18)21(26)17-7-3-5-9-19(17)24;/h2-9,15,22H,10-14H2,1H3;1H |
| InChIKey | OLIGMYWGDXLZFG-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 54.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.90 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|