C27H25N3O3 — CID 134051532
1-[2-(9-oxoacridin-10-yl)acetyl]-N-phenylpiperidine-3-carboxamide (PubChem CID 134051532) has the molecular formula C27H25N3O3 and a molecular weight of 439.52 g/mol. Its IUPAC name is 1-[2-(9-oxoacridin-10-yl)acetyl]-N-phenylpiperidine-3-carboxamide.
| Compound Name | 1-[2-(9-oxoacridin-10-yl)acetyl]-N-phenylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 134051532 |
| Molecular Formula | C27H25N3O3 |
| Molecular Weight | 439.52 g/mol |
| Exact Mass | 439.19 |
| IUPAC Name | 1-[2-(9-oxoacridin-10-yl)acetyl]-N-phenylpiperidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1CCCN(C(=O)Cn2c3ccccc3c(=O)c3ccccc32)C1 |
| InChI | InChI=1S/C27H25N3O3/c31-25(29-16-8-9-19(17-29)27(33)28-20-10-2-1-3-11-20)18-30-23-14-6-4-12-21(23)26(32)22-13-5-7-15-24(22)30/h1-7,10-15,19H,8-9,16-18H2,(H,28,33) |
| InChIKey | IBWKWGWBKHJFDE-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.52 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|