C17H21N3O3S — CID 18110525
1-[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]-N-phenylpiperidine-3-carboxamide (PubChem CID 18110525) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is 1-[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]-N-phenylpiperidine-3-carboxamide.
| Compound Name | 1-[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]-N-phenylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 18110525 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | 1-[2-(2-oxo-1,3-thiazolidin-3-yl)acetyl]-N-phenylpiperidine-3-carboxamide |
| SMILES | O=C(Nc1ccccc1)C1CCCN(C(=O)CN2CCSC2=O)C1 |
| InChI | InChI=1S/C17H21N3O3S/c21-15(12-20-9-10-24-17(20)23)19-8-4-5-13(11-19)16(22)18-14-6-2-1-3-7-14/h1-3,6-7,13H,4-5,8-12H2,(H,18,22) |
| InChIKey | PSTGTIOKSBWONQ-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|