C22H19ClFN3O2 — CID 56763911
(E)-3-(2-chlorophenyl)-1-[4-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]piperidin-1-yl]prop-2-en-1-one (PubChem CID 56763911) has the molecular formula C22H19ClFN3O2 and a molecular weight of 411.86 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-1-[4-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]piperidin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2-chlorophenyl)-1-[4-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]piperidin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 56763911 |
| Molecular Formula | C22H19ClFN3O2 |
| Molecular Weight | 411.86 g/mol |
| Exact Mass | 411.11 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-1-[4-[5-(4-fluorophenyl)-1,3,4-oxadiazol-2-yl]piperidin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1Cl)N1CCC(c2nnc(-c3ccc(F)cc3)o2)CC1 |
| InChI | InChI=1S/C22H19ClFN3O2/c23-19-4-2-1-3-15(19)7-10-20(28)27-13-11-17(12-14-27)22-26-25-21(29-22)16-5-8-18(24)9-6-16/h1-10,17H,11-14H2/b10-7+ |
| InChIKey | LDCGTUSKLLYJDD-JXMROGBWSA-N |
| XLogP | 4.95 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.86 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|