C20H21F2N3O4 — CID 55519565
1-[(E)-3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]-N-(5-methyl-1,2-oxazol-3-yl)piperidine-4-carboxamide (PubChem CID 55519565) has the molecular formula C20H21F2N3O4 and a molecular weight of 405.40 g/mol. Its IUPAC name is 1-[(E)-3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]-N-(5-methyl-1,2-oxazol-3-yl)piperidine-4-carboxamide.
| Compound Name | 1-[(E)-3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]-N-(5-methyl-1,2-oxazol-3-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 55519565 |
| Molecular Formula | C20H21F2N3O4 |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 1-[(E)-3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]-N-(5-methyl-1,2-oxazol-3-yl)piperidine-4-carboxamide |
| SMILES | Cc1cc(NC(=O)C2CCN(C(=O)/C=C/c3ccccc3OC(F)F)CC2)no1 |
| InChI | InChI=1S/C20H21F2N3O4/c1-13-12-17(24-29-13)23-19(27)15-8-10-25(11-9-15)18(26)7-6-14-4-2-3-5-16(14)28-20(21)22/h2-7,12,15,20H,8-11H2,1H3,(H,23,24,27)/b7-6+ |
| InChIKey | VFKHSURXEHXLEZ-VOTSOKGWSA-N |
| XLogP | 3.47 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|