C21H25N3O4 — CID 39702209
1-[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]-N-(5-methyl-1,2-oxazol-3-yl)piperidine-4-carboxamide (PubChem CID 39702209) has the molecular formula C21H25N3O4 and a molecular weight of 383.45 g/mol. Its IUPAC name is 1-[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]-N-(5-methyl-1,2-oxazol-3-yl)piperidine-4-carboxamide.
| Compound Name | 1-[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]-N-(5-methyl-1,2-oxazol-3-yl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 39702209 |
| Molecular Formula | C21H25N3O4 |
| Molecular Weight | 383.45 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 1-[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]-N-(5-methyl-1,2-oxazol-3-yl)piperidine-4-carboxamide |
| SMILES | CCOc1ccc(/C=C/C(=O)N2CCC(C(=O)Nc3cc(C)on3)CC2)cc1 |
| InChI | InChI=1S/C21H25N3O4/c1-3-27-18-7-4-16(5-8-18)6-9-20(25)24-12-10-17(11-13-24)21(26)22-19-14-15(2)28-23-19/h4-9,14,17H,3,10-13H2,1-2H3,(H,22,23,26)/b9-6+ |
| InChIKey | IXLCVGLTFSPEDO-RMKNXTFCSA-N |
| XLogP | 3.27 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.45 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|