C24H28N2O3 — CID 26456578
N-benzyl-1-[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]piperidine-4-carboxamide (PubChem CID 26456578) has the molecular formula C24H28N2O3 and a molecular weight of 392.50 g/mol. Its IUPAC name is N-benzyl-1-[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]piperidine-4-carboxamide.
| Compound Name | N-benzyl-1-[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 26456578 |
| Molecular Formula | C24H28N2O3 |
| Molecular Weight | 392.50 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | N-benzyl-1-[(E)-3-(4-ethoxyphenyl)prop-2-enoyl]piperidine-4-carboxamide |
| SMILES | CCOc1ccc(/C=C/C(=O)N2CCC(C(=O)NCc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C24H28N2O3/c1-2-29-22-11-8-19(9-12-22)10-13-23(27)26-16-14-21(15-17-26)24(28)25-18-20-6-4-3-5-7-20/h3-13,21H,2,14-18H2,1H3,(H,25,28)/b13-10+ |
| InChIKey | TUDSOCZLJXXHIH-JLHYYAGUSA-N |
| XLogP | 3.65 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.50 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|