C22H22Cl2N2O2 — CID 24560077
N-benzyl-1-[(E)-3-(3,5-dichlorophenyl)prop-2-enoyl]piperidine-4-carboxamide (PubChem CID 24560077) has the molecular formula C22H22Cl2N2O2 and a molecular weight of 417.34 g/mol. Its IUPAC name is N-benzyl-1-[(E)-3-(3,5-dichlorophenyl)prop-2-enoyl]piperidine-4-carboxamide.
| Compound Name | N-benzyl-1-[(E)-3-(3,5-dichlorophenyl)prop-2-enoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 24560077 |
| Molecular Formula | C22H22Cl2N2O2 |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 416.11 |
| IUPAC Name | N-benzyl-1-[(E)-3-(3,5-dichlorophenyl)prop-2-enoyl]piperidine-4-carboxamide |
| SMILES | O=C(NCc1ccccc1)C1CCN(C(=O)/C=C/c2cc(Cl)cc(Cl)c2)CC1 |
| InChI | InChI=1S/C22H22Cl2N2O2/c23-19-12-17(13-20(24)14-19)6-7-21(27)26-10-8-18(9-11-26)22(28)25-15-16-4-2-1-3-5-16/h1-7,12-14,18H,8-11,15H2,(H,25,28)/b7-6+ |
| InChIKey | LGJKYTVCUSBWKN-VOTSOKGWSA-N |
| XLogP | 4.56 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|