C26H30N2O4 — CID 38062485
N-benzyl-1-[(E)-3-(3-methoxy-4-prop-2-enoxyphenyl)prop-2-enoyl]piperidine-4-carboxamide (PubChem CID 38062485) has the molecular formula C26H30N2O4 and a molecular weight of 434.54 g/mol. Its IUPAC name is N-benzyl-1-[(E)-3-(3-methoxy-4-prop-2-enoxyphenyl)prop-2-enoyl]piperidine-4-carboxamide.
| Compound Name | N-benzyl-1-[(E)-3-(3-methoxy-4-prop-2-enoxyphenyl)prop-2-enoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 38062485 |
| Molecular Formula | C26H30N2O4 |
| Molecular Weight | 434.54 g/mol |
| Exact Mass | 434.22 |
| IUPAC Name | N-benzyl-1-[(E)-3-(3-methoxy-4-prop-2-enoxyphenyl)prop-2-enoyl]piperidine-4-carboxamide |
| SMILES | C=CCOc1ccc(/C=C/C(=O)N2CCC(C(=O)NCc3ccccc3)CC2)cc1OC |
| InChI | InChI=1S/C26H30N2O4/c1-3-17-32-23-11-9-20(18-24(23)31-2)10-12-25(29)28-15-13-22(14-16-28)26(30)27-19-21-7-5-4-6-8-21/h3-12,18,22H,1,13-17,19H2,2H3,(H,27,30)/b12-10+ |
| InChIKey | QUXBGWQXPLCQBS-ZRDIBKRKSA-N |
| XLogP | 3.83 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.54 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|