C26H31N3O2 — CID 46461401
1-[(E)-3-phenylprop-2-enoyl]-N-[(4-pyrrolidin-1-ylphenyl)methyl]piperidine-4-carboxamide (PubChem CID 46461401) has the molecular formula C26H31N3O2 and a molecular weight of 417.55 g/mol. Its IUPAC name is 1-[(E)-3-phenylprop-2-enoyl]-N-[(4-pyrrolidin-1-ylphenyl)methyl]piperidine-4-carboxamide.
| Compound Name | 1-[(E)-3-phenylprop-2-enoyl]-N-[(4-pyrrolidin-1-ylphenyl)methyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 46461401 |
| Molecular Formula | C26H31N3O2 |
| Molecular Weight | 417.55 g/mol |
| Exact Mass | 417.24 |
| IUPAC Name | 1-[(E)-3-phenylprop-2-enoyl]-N-[(4-pyrrolidin-1-ylphenyl)methyl]piperidine-4-carboxamide |
| SMILES | O=C(NCc1ccc(N2CCCC2)cc1)C1CCN(C(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C26H31N3O2/c30-25(13-10-21-6-2-1-3-7-21)29-18-14-23(15-19-29)26(31)27-20-22-8-11-24(12-9-22)28-16-4-5-17-28/h1-3,6-13,23H,4-5,14-20H2,(H,27,31)/b13-10+ |
| InChIKey | QYTILAJLFKYXKH-JLHYYAGUSA-N |
| XLogP | 3.86 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.55 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|