C19H24F3N3O2 — CID 110405067
N-[(4-pyrrolidin-1-ylphenyl)methyl]-1-(2,2,2-trifluoroacetyl)piperidine-4-carboxamide (PubChem CID 110405067) has the molecular formula C19H24F3N3O2 and a molecular weight of 383.41 g/mol. Its IUPAC name is N-[(4-pyrrolidin-1-ylphenyl)methyl]-1-(2,2,2-trifluoroacetyl)piperidine-4-carboxamide.
| Compound Name | N-[(4-pyrrolidin-1-ylphenyl)methyl]-1-(2,2,2-trifluoroacetyl)piperidine-4-carboxamide |
|---|---|
| PubChem CID | 110405067 |
| Molecular Formula | C19H24F3N3O2 |
| Molecular Weight | 383.41 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | N-[(4-pyrrolidin-1-ylphenyl)methyl]-1-(2,2,2-trifluoroacetyl)piperidine-4-carboxamide |
| SMILES | O=C(NCc1ccc(N2CCCC2)cc1)C1CCN(C(=O)C(F)(F)F)CC1 |
| InChI | InChI=1S/C19H24F3N3O2/c20-19(21,22)18(27)25-11-7-15(8-12-25)17(26)23-13-14-3-5-16(6-4-14)24-9-1-2-10-24/h3-6,15H,1-2,7-13H2,(H,23,26) |
| InChIKey | HAIXCTFAKLWCGB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|