C22H34N4O2 — CID 46473963
1-N,1-N-diethyl-4-N-[(4-pyrrolidin-1-ylphenyl)methyl]piperidine-1,4-dicarboxamide (PubChem CID 46473963) has the molecular formula C22H34N4O2 and a molecular weight of 386.54 g/mol. Its IUPAC name is 1-N,1-N-diethyl-4-N-[(4-pyrrolidin-1-ylphenyl)methyl]piperidine-1,4-dicarboxamide.
| Compound Name | 1-N,1-N-diethyl-4-N-[(4-pyrrolidin-1-ylphenyl)methyl]piperidine-1,4-dicarboxamide |
|---|---|
| PubChem CID | 46473963 |
| Molecular Formula | C22H34N4O2 |
| Molecular Weight | 386.54 g/mol |
| Exact Mass | 386.27 |
| IUPAC Name | 1-N,1-N-diethyl-4-N-[(4-pyrrolidin-1-ylphenyl)methyl]piperidine-1,4-dicarboxamide |
| SMILES | CCN(CC)C(=O)N1CCC(C(=O)NCc2ccc(N3CCCC3)cc2)CC1 |
| InChI | InChI=1S/C22H34N4O2/c1-3-24(4-2)22(28)26-15-11-19(12-16-26)21(27)23-17-18-7-9-20(10-8-18)25-13-5-6-14-25/h7-10,19H,3-6,11-17H2,1-2H3,(H,23,27) |
| InChIKey | AMOPYSSWJMOEKW-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.54 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|