C19H25F3N4O2 — CID 110405201
N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide (PubChem CID 110405201) has the molecular formula C19H25F3N4O2 and a molecular weight of 398.43 g/mol. Its IUPAC name is N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide.
| Compound Name | N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 110405201 |
| Molecular Formula | C19H25F3N4O2 |
| Molecular Weight | 398.43 g/mol |
| Exact Mass | 398.19 |
| IUPAC Name | N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]-1-(2,2,2-trifluoroacetyl)pyrrolidine-2-carboxamide |
| SMILES | CN1CCN(c2ccc(CNC(=O)C3CCCN3C(=O)C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C19H25F3N4O2/c1-24-9-11-25(12-10-24)15-6-4-14(5-7-15)13-23-17(27)16-3-2-8-26(16)18(28)19(20,21)22/h4-7,16H,2-3,8-13H2,1H3,(H,23,27) |
| InChIKey | AZALNYPALBLXJZ-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 55.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.43 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|