C18H22F3N3O3 — CID 110343907
2,2,2-trifluoro-1-[2-[4-(4-methoxyphenyl)piperazine-1-carbonyl]pyrrolidin-1-yl]ethanone (PubChem CID 110343907) has the molecular formula C18H22F3N3O3 and a molecular weight of 385.39 g/mol. Its IUPAC name is 2,2,2-trifluoro-1-[2-[4-(4-methoxyphenyl)piperazine-1-carbonyl]pyrrolidin-1-yl]ethanone.
| Compound Name | 2,2,2-trifluoro-1-[2-[4-(4-methoxyphenyl)piperazine-1-carbonyl]pyrrolidin-1-yl]ethanone |
|---|---|
| PubChem CID | 110343907 |
| Molecular Formula | C18H22F3N3O3 |
| Molecular Weight | 385.39 g/mol |
| Exact Mass | 385.16 |
| IUPAC Name | 2,2,2-trifluoro-1-[2-[4-(4-methoxyphenyl)piperazine-1-carbonyl]pyrrolidin-1-yl]ethanone |
| SMILES | COc1ccc(N2CCN(C(=O)C3CCCN3C(=O)C(F)(F)F)CC2)cc1 |
| InChI | InChI=1S/C18H22F3N3O3/c1-27-14-6-4-13(5-7-14)22-9-11-23(12-10-22)16(25)15-3-2-8-24(15)17(26)18(19,20)21/h4-7,15H,2-3,8-12H2,1H3 |
| InChIKey | ONUGWYGSSBOQRC-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 53.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.39 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|