C15H16F2N2O4 — CID 78905990
4-[3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]morpholine-2-carboxamide (PubChem CID 78905990) has the molecular formula C15H16F2N2O4 and a molecular weight of 326.30 g/mol. Its IUPAC name is 4-[3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]morpholine-2-carboxamide.
| Compound Name | 4-[3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 78905990 |
| Molecular Formula | C15H16F2N2O4 |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 4-[3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]morpholine-2-carboxamide |
| SMILES | NC(=O)C1CN(C(=O)C=Cc2ccccc2OC(F)F)CCO1 |
| InChI | InChI=1S/C15H16F2N2O4/c16-15(17)23-11-4-2-1-3-10(11)5-6-13(20)19-7-8-22-12(9-19)14(18)21/h1-6,12,15H,7-9H2,(H2,18,21) |
| InChIKey | NTRZHBIZZLOVBR-UHFFFAOYSA-N |
| XLogP | 1.01 |
| TPSA | 81.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|