C16H19NO5 — CID 75374480
2-[4-[(E)-3-(2-methoxyphenyl)prop-2-enoyl]morpholin-2-yl]acetic acid (PubChem CID 75374480) has the molecular formula C16H19NO5 and a molecular weight of 305.33 g/mol. Its IUPAC name is 2-[4-[(E)-3-(2-methoxyphenyl)prop-2-enoyl]morpholin-2-yl]acetic acid.
| Compound Name | 2-[4-[(E)-3-(2-methoxyphenyl)prop-2-enoyl]morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 75374480 |
| Molecular Formula | C16H19NO5 |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 305.13 |
| IUPAC Name | 2-[4-[(E)-3-(2-methoxyphenyl)prop-2-enoyl]morpholin-2-yl]acetic acid |
| SMILES | COc1ccccc1/C=C/C(=O)N1CCOC(CC(=O)O)C1 |
| InChI | InChI=1S/C16H19NO5/c1-21-14-5-3-2-4-12(14)6-7-15(18)17-8-9-22-13(11-17)10-16(19)20/h2-7,13H,8-11H2,1H3,(H,19,20)/b7-6+ |
| InChIKey | HMNPLEZOEFBTIQ-VOTSOKGWSA-N |
| XLogP | 1.41 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|