2-[4-(2,6-dimethoxybenzoyl)morpholin-2-yl]acetic acid

C15H19NO6 — CID 119942694

IUPAC2-[4-(2,6-dimethoxybenzoyl)morpholin-2-yl]acetic acid
SMILESCOc1cccc(OC)c1C(=O)N1CCOC(CC(=O)O)C1
InChIInChI=1S/C15H19NO6/c1-20-11-4-3-5-12(21-2)14(11)15(19)16-6-7-22-10(9-16)8-13(17)18/h3-5,10H,6-9H2,1-2H3,(H,17,18)
InChIKeyYVHHKTRVAQOFNW-UHFFFAOYSA-N
MW309.32 g/mol
LogP1.02
Rot. Bonds5

About 2-[4-(2,6-dimethoxybenzoyl)morpholin-2-yl]acetic acid

2-[4-(2,6-dimethoxybenzoyl)morpholin-2-yl]acetic acid (PubChem CID 119942694) has the molecular formula C15H19NO6 and a molecular weight of 309.32 g/mol. Its IUPAC name is 2-[4-(2,6-dimethoxybenzoyl)morpholin-2-yl]acetic acid.

Molecular Properties

Compound Name2-[4-(2,6-dimethoxybenzoyl)morpholin-2-yl]acetic acid
PubChem CID119942694
Molecular FormulaC15H19NO6
Molecular Weight309.32 g/mol
Exact Mass309.12
IUPAC Name2-[4-(2,6-dimethoxybenzoyl)morpholin-2-yl]acetic acid
SMILESCOc1cccc(OC)c1C(=O)N1CCOC(CC(=O)O)C1
InChIInChI=1S/C15H19NO6/c1-20-11-4-3-5-12(21-2)14(11)15(19)16-6-7-22-10(9-16)8-13(17)18/h3-5,10H,6-9H2,1-2H3,(H,17,18)
InChIKeyYVHHKTRVAQOFNW-UHFFFAOYSA-N
XLogP1.02
TPSA85.30 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500309.32
LogP ≤ 51.02
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Analyze 2-[4-(2,6-dimethoxybenzoyl)morpholin-2-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-(2,6-dimethoxybenzoyl)morpholin-2-yl]acetic acid?
The IUPAC name of 2-[4-(2,6-dimethoxybenzoyl)morpholin-2-yl]acetic acid (CID 119942694) is 2-[4-(2,6-dimethoxybenzoyl)morpholin-2-yl]acetic acid.
What is the SMILES notation for 2-[4-(2,6-dimethoxybenzoyl)morpholin-2-yl]acetic acid?
The canonical SMILES for 2-[4-(2,6-dimethoxybenzoyl)morpholin-2-yl]acetic acid is COc1cccc(OC)c1C(=O)N1CCOC(CC(=O)O)C1.
What is the InChIKey of 2-[4-(2,6-dimethoxybenzoyl)morpholin-2-yl]acetic acid?
The InChIKey is YVHHKTRVAQOFNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO6/c1-20-11-4-3-5-12(21-2)14(11)15(19)16-6-7-22-10(9-16)8-13(17)18/h3-5,10H,6-9H2,1-2H3,(H,17,18).
What are the key properties of 2-[4-(2,6-dimethoxybenzoyl)morpholin-2-yl]acetic acid?
2-[4-(2,6-dimethoxybenzoyl)morpholin-2-yl]acetic acid has a molecular weight of 309.32 g/mol, XLogP of 1.02, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(2,6-dimethoxybenzoyl)morpholin-2-yl]acetic acid is sourced from PubChem (CID 119942694), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).