C17H19NO6 — CID 119247509
2-[4-(8-methoxy-2H-chromene-3-carbonyl)morpholin-2-yl]acetic acid (PubChem CID 119247509) has the molecular formula C17H19NO6 and a molecular weight of 333.34 g/mol. Its IUPAC name is 2-[4-(8-methoxy-2H-chromene-3-carbonyl)morpholin-2-yl]acetic acid.
| Compound Name | 2-[4-(8-methoxy-2H-chromene-3-carbonyl)morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 119247509 |
| Molecular Formula | C17H19NO6 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 2-[4-(8-methoxy-2H-chromene-3-carbonyl)morpholin-2-yl]acetic acid |
| SMILES | COc1cccc2c1OCC(C(=O)N1CCOC(CC(=O)O)C1)=C2 |
| InChI | InChI=1S/C17H19NO6/c1-22-14-4-2-3-11-7-12(10-24-16(11)14)17(21)18-5-6-23-13(9-18)8-15(19)20/h2-4,7,13H,5-6,8-10H2,1H3,(H,19,20) |
| InChIKey | YRRPZORQQFJNDG-UHFFFAOYSA-N |
| XLogP | 1.17 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |