C11H9O4- — CID 6933959
8-methoxy-2H-chromene-3-carboxylate (PubChem CID 6933959) has the molecular formula C11H9O4- and a molecular weight of 205.19 g/mol. Its IUPAC name is 8-methoxy-2H-chromene-3-carboxylate.
| Compound Name | 8-methoxy-2H-chromene-3-carboxylate |
|---|---|
| PubChem CID | 6933959 |
| Molecular Formula | C11H9O4- |
| Molecular Weight | 205.19 g/mol |
| Exact Mass | 205.05 |
| IUPAC Name | 8-methoxy-2H-chromene-3-carboxylate |
| SMILES | COc1cccc2c1OCC(C(=O)[O-])=C2 |
| InChI | InChI=1S/C11H10O4/c1-14-9-4-2-3-7-5-8(11(12)13)6-15-10(7)9/h2-5H,6H2,1H3,(H,12,13)/p-1 |
| InChIKey | VAOZSTIKIWWEDB-UHFFFAOYSA-M |
| XLogP | 0.22 |
| TPSA | 58.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.19 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |