C18H21NO5 — CID 119113812
1-[(8-methoxy-2H-chromene-3-carbonyl)amino]cyclohexane-1-carboxylic acid (PubChem CID 119113812) has the molecular formula C18H21NO5 and a molecular weight of 331.37 g/mol. Its IUPAC name is 1-[(8-methoxy-2H-chromene-3-carbonyl)amino]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[(8-methoxy-2H-chromene-3-carbonyl)amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 119113812 |
| Molecular Formula | C18H21NO5 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 1-[(8-methoxy-2H-chromene-3-carbonyl)amino]cyclohexane-1-carboxylic acid |
| SMILES | COc1cccc2c1OCC(C(=O)NC1(C(=O)O)CCCCC1)=C2 |
| InChI | InChI=1S/C18H21NO5/c1-23-14-7-5-6-12-10-13(11-24-15(12)14)16(20)19-18(17(21)22)8-3-2-4-9-18/h5-7,10H,2-4,8-9,11H2,1H3,(H,19,20)(H,21,22) |
| InChIKey | DDDVDLRIMNFGAL-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |