2-[4-(3,4-dimethylbenzoyl)morpholin-2-yl]acetic acid

C15H19NO4 — CID 66433602

IUPAC2-[4-(3,4-dimethylbenzoyl)morpholin-2-yl]acetic acid
SMILESCc1ccc(C(=O)N2CCOC(CC(=O)O)C2)cc1C
InChIInChI=1S/C15H19NO4/c1-10-3-4-12(7-11(10)2)15(19)16-5-6-20-13(9-16)8-14(17)18/h3-4,7,13H,5-6,8-9H2,1-2H3,(H,17,18)
InChIKeyYPGUOTFBDPTZSO-UHFFFAOYSA-N
MW277.32 g/mol
LogP1.62
Rot. Bonds3

About 2-[4-(3,4-dimethylbenzoyl)morpholin-2-yl]acetic acid

2-[4-(3,4-dimethylbenzoyl)morpholin-2-yl]acetic acid (PubChem CID 66433602) has the molecular formula C15H19NO4 and a molecular weight of 277.32 g/mol. Its IUPAC name is 2-[4-(3,4-dimethylbenzoyl)morpholin-2-yl]acetic acid.

Molecular Properties

Compound Name2-[4-(3,4-dimethylbenzoyl)morpholin-2-yl]acetic acid
PubChem CID66433602
Molecular FormulaC15H19NO4
Molecular Weight277.32 g/mol
Exact Mass277.13
IUPAC Name2-[4-(3,4-dimethylbenzoyl)morpholin-2-yl]acetic acid
SMILESCc1ccc(C(=O)N2CCOC(CC(=O)O)C2)cc1C
InChIInChI=1S/C15H19NO4/c1-10-3-4-12(7-11(10)2)15(19)16-5-6-20-13(9-16)8-14(17)18/h3-4,7,13H,5-6,8-9H2,1-2H3,(H,17,18)
InChIKeyYPGUOTFBDPTZSO-UHFFFAOYSA-N
XLogP1.62
TPSA66.84 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms20
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500277.32
LogP ≤ 51.62
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-[4-(3,4-dimethylbenzoyl)morpholin-2-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[4-(3,4-dimethylbenzoyl)morpholin-2-yl]acetic acid?
The IUPAC name of 2-[4-(3,4-dimethylbenzoyl)morpholin-2-yl]acetic acid (CID 66433602) is 2-[4-(3,4-dimethylbenzoyl)morpholin-2-yl]acetic acid.
What is the SMILES notation for 2-[4-(3,4-dimethylbenzoyl)morpholin-2-yl]acetic acid?
The canonical SMILES for 2-[4-(3,4-dimethylbenzoyl)morpholin-2-yl]acetic acid is Cc1ccc(C(=O)N2CCOC(CC(=O)O)C2)cc1C.
What is the InChIKey of 2-[4-(3,4-dimethylbenzoyl)morpholin-2-yl]acetic acid?
The InChIKey is YPGUOTFBDPTZSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H19NO4/c1-10-3-4-12(7-11(10)2)15(19)16-5-6-20-13(9-16)8-14(17)18/h3-4,7,13H,5-6,8-9H2,1-2H3,(H,17,18).
What are the key properties of 2-[4-(3,4-dimethylbenzoyl)morpholin-2-yl]acetic acid?
2-[4-(3,4-dimethylbenzoyl)morpholin-2-yl]acetic acid has a molecular weight of 277.32 g/mol, XLogP of 1.62, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[4-(3,4-dimethylbenzoyl)morpholin-2-yl]acetic acid is sourced from PubChem (CID 66433602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).