C19H16F3NO4 — CID 124702697
2-[(2S)-4-[4-(3,4,5-trifluorophenyl)benzoyl]morpholin-2-yl]acetic acid (PubChem CID 124702697) has the molecular formula C19H16F3NO4 and a molecular weight of 379.33 g/mol. Its IUPAC name is 2-[(2S)-4-[4-(3,4,5-trifluorophenyl)benzoyl]morpholin-2-yl]acetic acid.
| Compound Name | 2-[(2S)-4-[4-(3,4,5-trifluorophenyl)benzoyl]morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 124702697 |
| Molecular Formula | C19H16F3NO4 |
| Molecular Weight | 379.33 g/mol |
| Exact Mass | 379.10 |
| IUPAC Name | 2-[(2S)-4-[4-(3,4,5-trifluorophenyl)benzoyl]morpholin-2-yl]acetic acid |
| SMILES | O=C(O)C[C@H]1CN(C(=O)c2ccc(-c3cc(F)c(F)c(F)c3)cc2)CCO1 |
| InChI | InChI=1S/C19H16F3NO4/c20-15-7-13(8-16(21)18(15)22)11-1-3-12(4-2-11)19(26)23-5-6-27-14(10-23)9-17(24)25/h1-4,7-8,14H,5-6,9-10H2,(H,24,25)/t14-/m0/s1 |
| InChIKey | TXLIHOPGEHHXMK-AWEZNQCLSA-N |
| XLogP | 3.09 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.33 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|