C17H21NO6 — CID 126777192
2-[4-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]morpholin-2-yl]acetic acid (PubChem CID 126777192) has the molecular formula C17H21NO6 and a molecular weight of 335.36 g/mol. Its IUPAC name is 2-[4-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]morpholin-2-yl]acetic acid.
| Compound Name | 2-[4-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]morpholin-2-yl]acetic acid |
|---|---|
| PubChem CID | 126777192 |
| Molecular Formula | C17H21NO6 |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.14 |
| IUPAC Name | 2-[4-[3-(3,4-dimethoxyphenyl)prop-2-enoyl]morpholin-2-yl]acetic acid |
| SMILES | COc1ccc(C=CC(=O)N2CCOC(CC(=O)O)C2)cc1OC |
| InChI | InChI=1S/C17H21NO6/c1-22-14-5-3-12(9-15(14)23-2)4-6-16(19)18-7-8-24-13(11-18)10-17(20)21/h3-6,9,13H,7-8,10-11H2,1-2H3,(H,20,21) |
| InChIKey | HEJSVEQQCVAFIN-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|