C14H15FN2O3 — CID 94371381
(2R)-4-[(E)-3-(3-fluorophenyl)prop-2-enoyl]morpholine-2-carboxamide (PubChem CID 94371381) has the molecular formula C14H15FN2O3 and a molecular weight of 278.28 g/mol. Its IUPAC name is (2R)-4-[(E)-3-(3-fluorophenyl)prop-2-enoyl]morpholine-2-carboxamide.
| Compound Name | (2R)-4-[(E)-3-(3-fluorophenyl)prop-2-enoyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 94371381 |
| Molecular Formula | C14H15FN2O3 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | (2R)-4-[(E)-3-(3-fluorophenyl)prop-2-enoyl]morpholine-2-carboxamide |
| SMILES | NC(=O)[C@H]1CN(C(=O)/C=C/c2cccc(F)c2)CCO1 |
| InChI | InChI=1S/C14H15FN2O3/c15-11-3-1-2-10(8-11)4-5-13(18)17-6-7-20-12(9-17)14(16)19/h1-5,8,12H,6-7,9H2,(H2,16,19)/b5-4+/t12-/m1/s1 |
| InChIKey | BRWASOLMLILRGL-ZYOFXKKJSA-N |
| XLogP | 0.55 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|