C18H17FN2O3S — CID 78905980
4-[3-[5-(4-fluorophenyl)thiophen-2-yl]prop-2-enoyl]morpholine-2-carboxamide (PubChem CID 78905980) has the molecular formula C18H17FN2O3S and a molecular weight of 360.41 g/mol. Its IUPAC name is 4-[3-[5-(4-fluorophenyl)thiophen-2-yl]prop-2-enoyl]morpholine-2-carboxamide.
| Compound Name | 4-[3-[5-(4-fluorophenyl)thiophen-2-yl]prop-2-enoyl]morpholine-2-carboxamide |
|---|---|
| PubChem CID | 78905980 |
| Molecular Formula | C18H17FN2O3S |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 4-[3-[5-(4-fluorophenyl)thiophen-2-yl]prop-2-enoyl]morpholine-2-carboxamide |
| SMILES | NC(=O)C1CN(C(=O)C=Cc2ccc(-c3ccc(F)cc3)s2)CCO1 |
| InChI | InChI=1S/C18H17FN2O3S/c19-13-3-1-12(2-4-13)16-7-5-14(25-16)6-8-17(22)21-9-10-24-15(11-21)18(20)23/h1-8,15H,9-11H2,(H2,20,23) |
| InChIKey | CCHSLDXHNCOLPO-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|