C18H18FNO2S — CID 43072228
(E)-3-[5-(4-fluorophenyl)thiophen-2-yl]-N-(oxolan-2-ylmethyl)prop-2-enamide (PubChem CID 43072228) has the molecular formula C18H18FNO2S and a molecular weight of 331.41 g/mol. Its IUPAC name is (E)-3-[5-(4-fluorophenyl)thiophen-2-yl]-N-(oxolan-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-[5-(4-fluorophenyl)thiophen-2-yl]-N-(oxolan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 43072228 |
| Molecular Formula | C18H18FNO2S |
| Molecular Weight | 331.41 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | (E)-3-[5-(4-fluorophenyl)thiophen-2-yl]-N-(oxolan-2-ylmethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(-c2ccc(F)cc2)s1)NCC1CCCO1 |
| InChI | InChI=1S/C18H18FNO2S/c19-14-5-3-13(4-6-14)17-9-7-16(23-17)8-10-18(21)20-12-15-2-1-11-22-15/h3-10,15H,1-2,11-12H2,(H,20,21)/b10-8+ |
| InChIKey | NVZVBYRMEPKNLO-CSKARUKUSA-N |
| XLogP | 3.86 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.41 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|