C12H14BrNO2S — CID 51148126
(E)-3-(5-bromothiophen-2-yl)-N-(oxolan-2-ylmethyl)prop-2-enamide (PubChem CID 51148126) has the molecular formula C12H14BrNO2S and a molecular weight of 316.22 g/mol. Its IUPAC name is (E)-3-(5-bromothiophen-2-yl)-N-(oxolan-2-ylmethyl)prop-2-enamide.
| Compound Name | (E)-3-(5-bromothiophen-2-yl)-N-(oxolan-2-ylmethyl)prop-2-enamide |
|---|---|
| PubChem CID | 51148126 |
| Molecular Formula | C12H14BrNO2S |
| Molecular Weight | 316.22 g/mol |
| Exact Mass | 314.99 |
| IUPAC Name | (E)-3-(5-bromothiophen-2-yl)-N-(oxolan-2-ylmethyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Br)s1)NCC1CCCO1 |
| InChI | InChI=1S/C12H14BrNO2S/c13-11-5-3-10(17-11)4-6-12(15)14-8-9-2-1-7-16-9/h3-6,9H,1-2,7-8H2,(H,14,15)/b6-4+ |
| InChIKey | BNJYLCVHRQKEKU-GQCTYLIASA-N |
| XLogP | 2.82 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.22 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|