C11H15BrN2O4S2 — CID 112991395
2-[(5-bromothiophen-2-yl)sulfonylamino]-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 112991395) has the molecular formula C11H15BrN2O4S2 and a molecular weight of 383.29 g/mol. Its IUPAC name is 2-[(5-bromothiophen-2-yl)sulfonylamino]-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-[(5-bromothiophen-2-yl)sulfonylamino]-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 112991395 |
| Molecular Formula | C11H15BrN2O4S2 |
| Molecular Weight | 383.29 g/mol |
| Exact Mass | 381.97 |
| IUPAC Name | 2-[(5-bromothiophen-2-yl)sulfonylamino]-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | O=C(CNS(=O)(=O)c1ccc(Br)s1)NCC1CCCO1 |
| InChI | InChI=1S/C11H15BrN2O4S2/c12-9-3-4-11(19-9)20(16,17)14-7-10(15)13-6-8-2-1-5-18-8/h3-4,8,14H,1-2,5-7H2,(H,13,15) |
| InChIKey | YSUJOYPYYNOGDU-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.29 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |