C12H18BrN3O3S2 — CID 119464585
2-[(5-bromothiophen-2-yl)sulfonylamino]-N-(piperidin-3-ylmethyl)acetamide (PubChem CID 119464585) has the molecular formula C12H18BrN3O3S2 and a molecular weight of 396.33 g/mol. Its IUPAC name is 2-[(5-bromothiophen-2-yl)sulfonylamino]-N-(piperidin-3-ylmethyl)acetamide.
| Compound Name | 2-[(5-bromothiophen-2-yl)sulfonylamino]-N-(piperidin-3-ylmethyl)acetamide |
|---|---|
| PubChem CID | 119464585 |
| Molecular Formula | C12H18BrN3O3S2 |
| Molecular Weight | 396.33 g/mol |
| Exact Mass | 395.00 |
| IUPAC Name | 2-[(5-bromothiophen-2-yl)sulfonylamino]-N-(piperidin-3-ylmethyl)acetamide |
| SMILES | O=C(CNS(=O)(=O)c1ccc(Br)s1)NCC1CCCNC1 |
| InChI | InChI=1S/C12H18BrN3O3S2/c13-10-3-4-12(20-10)21(18,19)16-8-11(17)15-7-9-2-1-5-14-6-9/h3-4,9,14,16H,1-2,5-8H2,(H,15,17) |
| InChIKey | ZZFTZYQELVNDPE-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.33 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |