C12H18BrNO2S2 — CID 55026778
5-bromo-N-(2-cyclohexylethyl)thiophene-2-sulfonamide (PubChem CID 55026778) has the molecular formula C12H18BrNO2S2 and a molecular weight of 352.32 g/mol. Its IUPAC name is 5-bromo-N-(2-cyclohexylethyl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-(2-cyclohexylethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 55026778 |
| Molecular Formula | C12H18BrNO2S2 |
| Molecular Weight | 352.32 g/mol |
| Exact Mass | 351.00 |
| IUPAC Name | 5-bromo-N-(2-cyclohexylethyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCCC1CCCCC1)c1ccc(Br)s1 |
| InChI | InChI=1S/C12H18BrNO2S2/c13-11-6-7-12(17-11)18(15,16)14-9-8-10-4-2-1-3-5-10/h6-7,10,14H,1-5,8-9H2 |
| InChIKey | VCLGLXCEIUCRTM-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.32 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |