C9H12BrNO2S3 — CID 107297938
5-bromo-N-(thiolan-3-ylmethyl)thiophene-2-sulfonamide (PubChem CID 107297938) has the molecular formula C9H12BrNO2S3 and a molecular weight of 342.31 g/mol. Its IUPAC name is 5-bromo-N-(thiolan-3-ylmethyl)thiophene-2-sulfonamide.
| Compound Name | 5-bromo-N-(thiolan-3-ylmethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 107297938 |
| Molecular Formula | C9H12BrNO2S3 |
| Molecular Weight | 342.31 g/mol |
| Exact Mass | 340.92 |
| IUPAC Name | 5-bromo-N-(thiolan-3-ylmethyl)thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NCC1CCSC1)c1ccc(Br)s1 |
| InChI | InChI=1S/C9H12BrNO2S3/c10-8-1-2-9(15-8)16(12,13)11-5-7-3-4-14-6-7/h1-2,7,11H,3-6H2 |
| InChIKey | LMWMQHLOYDRIFW-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |