C11H18N2O2S3 — CID 106089015
5-(methylaminomethyl)-N-(thiolan-3-ylmethyl)thiophene-2-sulfonamide (PubChem CID 106089015) has the molecular formula C11H18N2O2S3 and a molecular weight of 306.48 g/mol. Its IUPAC name is 5-(methylaminomethyl)-N-(thiolan-3-ylmethyl)thiophene-2-sulfonamide.
| Compound Name | 5-(methylaminomethyl)-N-(thiolan-3-ylmethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106089015 |
| Molecular Formula | C11H18N2O2S3 |
| Molecular Weight | 306.48 g/mol |
| Exact Mass | 306.05 |
| IUPAC Name | 5-(methylaminomethyl)-N-(thiolan-3-ylmethyl)thiophene-2-sulfonamide |
| SMILES | CNCc1ccc(S(=O)(=O)NCC2CCSC2)s1 |
| InChI | InChI=1S/C11H18N2O2S3/c1-12-7-10-2-3-11(17-10)18(14,15)13-6-9-4-5-16-8-9/h2-3,9,12-13H,4-8H2,1H3 |
| InChIKey | AZZVCHLMSYQTMR-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.48 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |