C13H22N2O3S2 — CID 106064530
N-(2-cyclopentyloxyethyl)-5-(methylaminomethyl)thiophene-2-sulfonamide (PubChem CID 106064530) has the molecular formula C13H22N2O3S2 and a molecular weight of 318.46 g/mol. Its IUPAC name is N-(2-cyclopentyloxyethyl)-5-(methylaminomethyl)thiophene-2-sulfonamide.
| Compound Name | N-(2-cyclopentyloxyethyl)-5-(methylaminomethyl)thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 106064530 |
| Molecular Formula | C13H22N2O3S2 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.11 |
| IUPAC Name | N-(2-cyclopentyloxyethyl)-5-(methylaminomethyl)thiophene-2-sulfonamide |
| SMILES | CNCc1ccc(S(=O)(=O)NCCOC2CCCC2)s1 |
| InChI | InChI=1S/C13H22N2O3S2/c1-14-10-12-6-7-13(19-12)20(16,17)15-8-9-18-11-4-2-3-5-11/h6-7,11,14-15H,2-5,8-10H2,1H3 |
| InChIKey | FGRUORVAXCUWGC-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|