C10H18N4O2S2 — CID 106089063
4-(methylaminomethyl)-N-(thiolan-3-ylmethyl)-1H-pyrazole-5-sulfonamide (PubChem CID 106089063) has the molecular formula C10H18N4O2S2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 4-(methylaminomethyl)-N-(thiolan-3-ylmethyl)-1H-pyrazole-5-sulfonamide.
| Compound Name | 4-(methylaminomethyl)-N-(thiolan-3-ylmethyl)-1H-pyrazole-5-sulfonamide |
|---|---|
| PubChem CID | 106089063 |
| Molecular Formula | C10H18N4O2S2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.09 |
| IUPAC Name | 4-(methylaminomethyl)-N-(thiolan-3-ylmethyl)-1H-pyrazole-5-sulfonamide |
| SMILES | CNCc1cn[nH]c1S(=O)(=O)NCC1CCSC1 |
| InChI | InChI=1S/C10H18N4O2S2/c1-11-5-9-6-12-14-10(9)18(15,16)13-4-8-2-3-17-7-8/h6,8,11,13H,2-5,7H2,1H3,(H,12,14) |
| InChIKey | CZEOQXMOUGOEAT-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 86.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |