C20H18F4N2O4S — CID 16596357
(E)-3-[2-(difluoromethoxy)phenyl]-1-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 16596357) has the molecular formula C20H18F4N2O4S and a molecular weight of 458.43 g/mol. Its IUPAC name is (E)-3-[2-(difluoromethoxy)phenyl]-1-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-[2-(difluoromethoxy)phenyl]-1-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 16596357 |
| Molecular Formula | C20H18F4N2O4S |
| Molecular Weight | 458.43 g/mol |
| Exact Mass | 458.09 |
| IUPAC Name | (E)-3-[2-(difluoromethoxy)phenyl]-1-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1OC(F)F)N1CCN(S(=O)(=O)c2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C20H18F4N2O4S/c21-15-5-3-6-16(22)19(15)31(28,29)26-12-10-25(11-13-26)18(27)9-8-14-4-1-2-7-17(14)30-20(23)24/h1-9,20H,10-13H2/b9-8+ |
| InChIKey | BJSYYJCWOLAXDI-CMDGGOBGSA-N |
| XLogP | 3.11 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.43 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|