C19H18F2N2O3S — CID 7958565
(E)-1-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-3-phenylprop-2-en-1-one (PubChem CID 7958565) has the molecular formula C19H18F2N2O3S and a molecular weight of 392.43 g/mol. Its IUPAC name is (E)-1-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-3-phenylprop-2-en-1-one.
| Compound Name | (E)-1-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-3-phenylprop-2-en-1-one |
|---|---|
| PubChem CID | 7958565 |
| Molecular Formula | C19H18F2N2O3S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | (E)-1-[4-(2,6-difluorophenyl)sulfonylpiperazin-1-yl]-3-phenylprop-2-en-1-one |
| SMILES | O=C(/C=C/c1ccccc1)N1CCN(S(=O)(=O)c2c(F)cccc2F)CC1 |
| InChI | InChI=1S/C19H18F2N2O3S/c20-16-7-4-8-17(21)19(16)27(25,26)23-13-11-22(12-14-23)18(24)10-9-15-5-2-1-3-6-15/h1-10H,11-14H2/b10-9+ |
| InChIKey | DSDJSSPDSUWADW-MDZDMXLPSA-N |
| XLogP | 2.51 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|