C20H18F4N2O3S — CID 6214196
(E)-1-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-3-[3-(trifluoromethyl)phenyl]prop-2-en-1-one (PubChem CID 6214196) has the molecular formula C20H18F4N2O3S and a molecular weight of 442.43 g/mol. Its IUPAC name is (E)-1-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-3-[3-(trifluoromethyl)phenyl]prop-2-en-1-one.
| Compound Name | (E)-1-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-3-[3-(trifluoromethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 6214196 |
| Molecular Formula | C20H18F4N2O3S |
| Molecular Weight | 442.43 g/mol |
| Exact Mass | 442.10 |
| IUPAC Name | (E)-1-[4-(2-fluorophenyl)sulfonylpiperazin-1-yl]-3-[3-(trifluoromethyl)phenyl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1cccc(C(F)(F)F)c1)N1CCN(S(=O)(=O)c2ccccc2F)CC1 |
| InChI | InChI=1S/C20H18F4N2O3S/c21-17-6-1-2-7-18(17)30(28,29)26-12-10-25(11-13-26)19(27)9-8-15-4-3-5-16(14-15)20(22,23)24/h1-9,14H,10-13H2/b9-8+ |
| InChIKey | KRSRJASJNIHEAL-CMDGGOBGSA-N |
| XLogP | 3.39 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.43 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|