C24H21F3N2O3S — CID 4799546
1-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-3-[3-(trifluoromethyl)phenyl]prop-2-en-1-one (PubChem CID 4799546) has the molecular formula C24H21F3N2O3S and a molecular weight of 474.50 g/mol. Its IUPAC name is 1-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-3-[3-(trifluoromethyl)phenyl]prop-2-en-1-one.
| Compound Name | 1-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-3-[3-(trifluoromethyl)phenyl]prop-2-en-1-one |
|---|---|
| PubChem CID | 4799546 |
| Molecular Formula | C24H21F3N2O3S |
| Molecular Weight | 474.50 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | 1-(4-naphthalen-2-ylsulfonylpiperazin-1-yl)-3-[3-(trifluoromethyl)phenyl]prop-2-en-1-one |
| SMILES | O=C(C=Cc1cccc(C(F)(F)F)c1)N1CCN(S(=O)(=O)c2ccc3ccccc3c2)CC1 |
| InChI | InChI=1S/C24H21F3N2O3S/c25-24(26,27)21-7-3-4-18(16-21)8-11-23(30)28-12-14-29(15-13-28)33(31,32)22-10-9-19-5-1-2-6-20(19)17-22/h1-11,16-17H,12-15H2 |
| InChIKey | MHRCYOBBJYMHMQ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.50 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|