C20H17F5N2O3S — CID 55704218
(E)-3-(2,6-difluorophenyl)-1-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]prop-2-en-1-one (PubChem CID 55704218) has the molecular formula C20H17F5N2O3S and a molecular weight of 460.42 g/mol. Its IUPAC name is (E)-3-(2,6-difluorophenyl)-1-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]prop-2-en-1-one.
| Compound Name | (E)-3-(2,6-difluorophenyl)-1-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]prop-2-en-1-one |
|---|---|
| PubChem CID | 55704218 |
| Molecular Formula | C20H17F5N2O3S |
| Molecular Weight | 460.42 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | (E)-3-(2,6-difluorophenyl)-1-[4-[4-(trifluoromethyl)phenyl]sulfonylpiperazin-1-yl]prop-2-en-1-one |
| SMILES | O=C(/C=C/c1c(F)cccc1F)N1CCN(S(=O)(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C20H17F5N2O3S/c21-17-2-1-3-18(22)16(17)8-9-19(28)26-10-12-27(13-11-26)31(29,30)15-6-4-14(5-7-15)20(23,24)25/h1-9H,10-13H2/b9-8+ |
| InChIKey | HSQLEFJHWKLOMK-CMDGGOBGSA-N |
| XLogP | 3.53 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.42 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|