C21H30N4O5S — CID 55636558
(E)-N-[2-[4-(2,6-dimethylmorpholin-4-yl)sulfonylpiperazin-1-yl]-2-oxoethyl]-3-phenylprop-2-enamide (PubChem CID 55636558) has the molecular formula C21H30N4O5S and a molecular weight of 450.56 g/mol. Its IUPAC name is (E)-N-[2-[4-(2,6-dimethylmorpholin-4-yl)sulfonylpiperazin-1-yl]-2-oxoethyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[2-[4-(2,6-dimethylmorpholin-4-yl)sulfonylpiperazin-1-yl]-2-oxoethyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 55636558 |
| Molecular Formula | C21H30N4O5S |
| Molecular Weight | 450.56 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | (E)-N-[2-[4-(2,6-dimethylmorpholin-4-yl)sulfonylpiperazin-1-yl]-2-oxoethyl]-3-phenylprop-2-enamide |
| SMILES | CC1CN(S(=O)(=O)N2CCN(C(=O)CNC(=O)/C=C/c3ccccc3)CC2)CC(C)O1 |
| InChI | InChI=1S/C21H30N4O5S/c1-17-15-25(16-18(2)30-17)31(28,29)24-12-10-23(11-13-24)21(27)14-22-20(26)9-8-19-6-4-3-5-7-19/h3-9,17-18H,10-16H2,1-2H3,(H,22,26)/b9-8+ |
| InChIKey | OILTUEKPSMCLIC-CMDGGOBGSA-N |
| XLogP | 0.31 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.56 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|