C18H26N4O6S — CID 51938844
1-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonylpiperazin-1-yl]-2-(4-nitrophenyl)ethanone (PubChem CID 51938844) has the molecular formula C18H26N4O6S and a molecular weight of 426.50 g/mol. Its IUPAC name is 1-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonylpiperazin-1-yl]-2-(4-nitrophenyl)ethanone.
| Compound Name | 1-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonylpiperazin-1-yl]-2-(4-nitrophenyl)ethanone |
|---|---|
| PubChem CID | 51938844 |
| Molecular Formula | C18H26N4O6S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | 1-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]sulfonylpiperazin-1-yl]-2-(4-nitrophenyl)ethanone |
| SMILES | C[C@@H]1CN(S(=O)(=O)N2CCN(C(=O)Cc3ccc([N+](=O)[O-])cc3)CC2)C[C@H](C)O1 |
| InChI | InChI=1S/C18H26N4O6S/c1-14-12-21(13-15(2)28-14)29(26,27)20-9-7-19(8-10-20)18(23)11-16-3-5-17(6-4-16)22(24)25/h3-6,14-15H,7-13H2,1-2H3/t14-,15+ |
| InChIKey | RTKLOHQYVPKUJT-GASCZTMLSA-N |
| XLogP | 0.64 |
| TPSA | 113.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|