C18H26N4O6S — CID 51937054
[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylpiperazin-1-yl]-(4-methyl-3-nitrophenyl)methanone (PubChem CID 51937054) has the molecular formula C18H26N4O6S and a molecular weight of 426.50 g/mol. Its IUPAC name is [4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylpiperazin-1-yl]-(4-methyl-3-nitrophenyl)methanone.
| Compound Name | [4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylpiperazin-1-yl]-(4-methyl-3-nitrophenyl)methanone |
|---|---|
| PubChem CID | 51937054 |
| Molecular Formula | C18H26N4O6S |
| Molecular Weight | 426.50 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | [4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]sulfonylpiperazin-1-yl]-(4-methyl-3-nitrophenyl)methanone |
| SMILES | Cc1ccc(C(=O)N2CCN(S(=O)(=O)N3C[C@H](C)O[C@@H](C)C3)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H26N4O6S/c1-13-4-5-16(10-17(13)22(24)25)18(23)19-6-8-20(9-7-19)29(26,27)21-11-14(2)28-15(3)12-21/h4-5,10,14-15H,6-9,11-12H2,1-3H3/t14-,15-/m0/s1 |
| InChIKey | NXZFJOUGXXQTFE-GJZGRUSLSA-N |
| XLogP | 1.02 |
| TPSA | 113.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.50 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|