C21H21F3N2O4S — CID 72687890
N-[1-[3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]piperidin-3-yl]-3-fluorobenzenesulfonamide (PubChem CID 72687890) has the molecular formula C21H21F3N2O4S and a molecular weight of 454.47 g/mol. Its IUPAC name is N-[1-[3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]piperidin-3-yl]-3-fluorobenzenesulfonamide.
| Compound Name | N-[1-[3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]piperidin-3-yl]-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 72687890 |
| Molecular Formula | C21H21F3N2O4S |
| Molecular Weight | 454.47 g/mol |
| Exact Mass | 454.12 |
| IUPAC Name | N-[1-[3-[2-(difluoromethoxy)phenyl]prop-2-enoyl]piperidin-3-yl]-3-fluorobenzenesulfonamide |
| SMILES | O=C(C=Cc1ccccc1OC(F)F)N1CCCC(NS(=O)(=O)c2cccc(F)c2)C1 |
| InChI | InChI=1S/C21H21F3N2O4S/c22-16-6-3-8-18(13-16)31(28,29)25-17-7-4-12-26(14-17)20(27)11-10-15-5-1-2-9-19(15)30-21(23)24/h1-3,5-6,8-11,13,17,21,25H,4,7,12,14H2 |
| InChIKey | FGOCPWWKACFRMT-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.47 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|