C20H20ClFN2O3S — CID 72687849
N-[1-[3-(4-chlorophenyl)prop-2-enoyl]piperidin-3-yl]-3-fluorobenzenesulfonamide (PubChem CID 72687849) has the molecular formula C20H20ClFN2O3S and a molecular weight of 422.91 g/mol. Its IUPAC name is N-[1-[3-(4-chlorophenyl)prop-2-enoyl]piperidin-3-yl]-3-fluorobenzenesulfonamide.
| Compound Name | N-[1-[3-(4-chlorophenyl)prop-2-enoyl]piperidin-3-yl]-3-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 72687849 |
| Molecular Formula | C20H20ClFN2O3S |
| Molecular Weight | 422.91 g/mol |
| Exact Mass | 422.09 |
| IUPAC Name | N-[1-[3-(4-chlorophenyl)prop-2-enoyl]piperidin-3-yl]-3-fluorobenzenesulfonamide |
| SMILES | O=C(C=Cc1ccc(Cl)cc1)N1CCCC(NS(=O)(=O)c2cccc(F)c2)C1 |
| InChI | InChI=1S/C20H20ClFN2O3S/c21-16-9-6-15(7-10-16)8-11-20(25)24-12-2-4-18(14-24)23-28(26,27)19-5-1-3-17(22)13-19/h1,3,5-11,13,18,23H,2,4,12,14H2 |
| InChIKey | PYCVKNMUDKUSGK-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.91 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|