C17H21FN2O3S — CID 72687865
3-fluoro-N-(1-hexa-2,4-dienoylpiperidin-3-yl)benzenesulfonamide (PubChem CID 72687865) has the molecular formula C17H21FN2O3S and a molecular weight of 352.43 g/mol. Its IUPAC name is 3-fluoro-N-(1-hexa-2,4-dienoylpiperidin-3-yl)benzenesulfonamide.
| Compound Name | 3-fluoro-N-(1-hexa-2,4-dienoylpiperidin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 72687865 |
| Molecular Formula | C17H21FN2O3S |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.13 |
| IUPAC Name | 3-fluoro-N-(1-hexa-2,4-dienoylpiperidin-3-yl)benzenesulfonamide |
| SMILES | CC=CC=CC(=O)N1CCCC(NS(=O)(=O)c2cccc(F)c2)C1 |
| InChI | InChI=1S/C17H21FN2O3S/c1-2-3-4-10-17(21)20-11-6-8-15(13-20)19-24(22,23)16-9-5-7-14(18)12-16/h2-5,7,9-10,12,15,19H,6,8,11,13H2,1H3 |
| InChIKey | ODYSQGWOPWKXPL-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|