C14H19FN2O4S — CID 119921741
2-[3-[(3-fluorophenyl)sulfonylamino]piperidin-1-yl]propanoic acid (PubChem CID 119921741) has the molecular formula C14H19FN2O4S and a molecular weight of 330.38 g/mol. Its IUPAC name is 2-[3-[(3-fluorophenyl)sulfonylamino]piperidin-1-yl]propanoic acid.
| Compound Name | 2-[3-[(3-fluorophenyl)sulfonylamino]piperidin-1-yl]propanoic acid |
|---|---|
| PubChem CID | 119921741 |
| Molecular Formula | C14H19FN2O4S |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 2-[3-[(3-fluorophenyl)sulfonylamino]piperidin-1-yl]propanoic acid |
| SMILES | CC(C(=O)O)N1CCCC(NS(=O)(=O)c2cccc(F)c2)C1 |
| InChI | InChI=1S/C14H19FN2O4S/c1-10(14(18)19)17-7-3-5-12(9-17)16-22(20,21)13-6-2-4-11(15)8-13/h2,4,6,8,10,12,16H,3,5,7,9H2,1H3,(H,18,19) |
| InChIKey | JYGXOBPBFYGIER-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |